C14H17N5O2 — CID 80866937
4-(3-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80866937) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-(3-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80866937 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 4-(3-methoxyphenoxy)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | COc1cccc(Oc2nc(N)nc(N3CCCC3)n2)c1 |
| InChI | InChI=1S/C14H17N5O2/c1-20-10-5-4-6-11(9-10)21-14-17-12(15)16-13(18-14)19-7-2-3-8-19/h4-6,9H,2-3,7-8H2,1H3,(H2,15,16,17,18) |
| InChIKey | RUANJDDFSBYIMM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |