C12H19ClN4O — CID 62857566
2-chloro-4-ethoxy-6-(3-ethylpiperidin-1-yl)-1,3,5-triazine (PubChem CID 62857566) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-(3-ethylpiperidin-1-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-(3-ethylpiperidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 62857566 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-chloro-4-ethoxy-6-(3-ethylpiperidin-1-yl)-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(N2CCCC(CC)C2)n1 |
| InChI | InChI=1S/C12H19ClN4O/c1-3-9-6-5-7-17(8-9)11-14-10(13)15-12(16-11)18-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | MUBFXTDHLVYOTQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |