C11H16ClN5O2 — CID 62859553
1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidine-3-carboxamide (PubChem CID 62859553) has the molecular formula C11H16ClN5O2 and a molecular weight of 285.74 g/mol. Its IUPAC name is 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 62859553 |
| Molecular Formula | C11H16ClN5O2 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)piperidine-3-carboxamide |
| SMILES | CCOc1nc(Cl)nc(N2CCCC(C(N)=O)C2)n1 |
| InChI | InChI=1S/C11H16ClN5O2/c1-2-19-11-15-9(12)14-10(16-11)17-5-3-4-7(6-17)8(13)18/h7H,2-6H2,1H3,(H2,13,18) |
| InChIKey | KZCNNDHYDDYPNU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |