C8H11N7O3 — CID 80921274
4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-2,6-dione (PubChem CID 80921274) has the molecular formula C8H11N7O3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-2,6-dione.
| Compound Name | 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80921274 |
| Molecular Formula | C8H11N7O3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 4-(4-hydrazinyl-6-methoxy-1,3,5-triazin-2-yl)piperazine-2,6-dione |
| SMILES | COc1nc(NN)nc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C8H11N7O3/c1-18-8-12-6(14-9)11-7(13-8)15-2-4(16)10-5(17)3-15/h2-3,9H2,1H3,(H,10,16,17)(H,11,12,13,14) |
| InChIKey | FXWQJKSOTZWIFY-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|