C10H14N6O3 — CID 80855575
4-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]piperazine-2,6-dione (PubChem CID 80855575) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 4-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]piperazine-2,6-dione.
| Compound Name | 4-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80855575 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[4-(ethylamino)-6-methoxy-1,3,5-triazin-2-yl]piperazine-2,6-dione |
| SMILES | CCNc1nc(OC)nc(N2CC(=O)NC(=O)C2)n1 |
| InChI | InChI=1S/C10H14N6O3/c1-3-11-8-13-9(15-10(14-8)19-2)16-4-6(17)12-7(18)5-16/h3-5H2,1-2H3,(H,12,17,18)(H,11,13,14,15) |
| InChIKey | QRXFAODKQROXGU-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|