C12H21N7O2 — CID 115967487
[1-(4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol (PubChem CID 115967487) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is [1-(4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 115967487 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [1-(4-hydrazinyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)pyrrolidin-3-yl]methanol |
| SMILES | NNc1nc(N2CCOCC2)nc(N2CCC(CO)C2)n1 |
| InChI | InChI=1S/C12H21N7O2/c13-17-10-14-11(18-3-5-21-6-4-18)16-12(15-10)19-2-1-9(7-19)8-20/h9,20H,1-8,13H2,(H,14,15,16,17) |
| InChIKey | ZXZOMHJPSMKXKJ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|