C9H10ClN5O2 — CID 80850976
4-(2-amino-5-chloropyrimidin-4-yl)-3-methylpiperazine-2,6-dione (PubChem CID 80850976) has the molecular formula C9H10ClN5O2 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-(2-amino-5-chloropyrimidin-4-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2-amino-5-chloropyrimidin-4-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80850976 |
| Molecular Formula | C9H10ClN5O2 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-(2-amino-5-chloropyrimidin-4-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1nc(N)ncc1Cl |
| InChI | InChI=1S/C9H10ClN5O2/c1-4-8(17)13-6(16)3-15(4)7-5(10)2-12-9(11)14-7/h2,4H,3H2,1H3,(H2,11,12,14)(H,13,16,17) |
| InChIKey | QQMQPIUQGGZURZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|