C10H14N6O2 — CID 80850978
4-[2-amino-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione (PubChem CID 80850978) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 4-[2-amino-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[2-amino-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80850978 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-[2-amino-6-(methylamino)pyrimidin-4-yl]-3-methylpiperazine-2,6-dione |
| SMILES | CNc1cc(N2CC(=O)NC(=O)C2C)nc(N)n1 |
| InChI | InChI=1S/C10H14N6O2/c1-5-9(18)15-8(17)4-16(5)7-3-6(12-2)13-10(11)14-7/h3,5H,4H2,1-2H3,(H,15,17,18)(H3,11,12,13,14) |
| InChIKey | PGLQKQRZXNWJIS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|