C11H15N5O2 — CID 80851054
3-methyl-4-[2-methyl-6-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione (PubChem CID 80851054) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-methyl-4-[2-methyl-6-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione.
| Compound Name | 3-methyl-4-[2-methyl-6-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 80851054 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-methyl-4-[2-methyl-6-(methylamino)pyrimidin-4-yl]piperazine-2,6-dione |
| SMILES | CNc1cc(N2CC(=O)NC(=O)C2C)nc(C)n1 |
| InChI | InChI=1S/C11H15N5O2/c1-6-11(18)15-10(17)5-16(6)9-4-8(12-3)13-7(2)14-9/h4,6H,5H2,1-3H3,(H,12,13,14)(H,15,17,18) |
| InChIKey | FRLOXXGSISMEAM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|