C12H13N5O2S — CID 103328722
3-methyl-4-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]piperazine-2,6-dione (PubChem CID 103328722) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-methyl-4-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]piperazine-2,6-dione.
| Compound Name | 3-methyl-4-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 103328722 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-methyl-4-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]piperazine-2,6-dione |
| SMILES | CNc1nc(N2CC(=O)NC(=O)C2C)c2ccsc2n1 |
| InChI | InChI=1S/C12H13N5O2S/c1-6-10(19)14-8(18)5-17(6)9-7-3-4-20-11(7)16-12(13-2)15-9/h3-4,6H,5H2,1-2H3,(H,13,15,16)(H,14,18,19) |
| InChIKey | YULFFKKTDJOKFE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|