C14H17N5OS — CID 103330918
1-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 103330918) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 1-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 103330918 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-[2-(methylamino)thieno[2,3-d]pyrimidin-4-yl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | CNc1nc(N2CCCC3C(=O)NCC32)c2ccsc2n1 |
| InChI | InChI=1S/C14H17N5OS/c1-15-14-17-11(9-4-6-21-13(9)18-14)19-5-2-3-8-10(19)7-16-12(8)20/h4,6,8,10H,2-3,5,7H2,1H3,(H,16,20)(H,15,17,18) |
| InChIKey | KSRTVQYKVUWFLU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |