C12H16N6O2 — CID 80968597
4-(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)-3-methylpiperazine-2,6-dione (PubChem CID 80968597) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 80968597 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(2-cyclopropyl-6-hydrazinylpyrimidin-4-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1cc(NN)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H16N6O2/c1-6-12(20)16-10(19)5-18(6)9-4-8(17-13)14-11(15-9)7-2-3-7/h4,6-7H,2-3,5,13H2,1H3,(H,14,15,17)(H,16,19,20) |
| InChIKey | IIBYGZYYOLLGKU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|