C11H15N7 — CID 80969657
[2-cyclopropyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80969657) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is [2-cyclopropyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-cyclopropyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80969657 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [2-cyclopropyl-6-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(C)n(-c2cc(NN)nc(C3CC3)n2)n1 |
| InChI | InChI=1S/C11H15N7/c1-6-13-7(2)18(17-6)10-5-9(16-12)14-11(15-10)8-3-4-8/h5,8H,3-4,12H2,1-2H3,(H,14,15,16) |
| InChIKey | GUZGNMFMVUQGFW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|