C14H14N6 — CID 80968413
(2-cyclopropyl-6-indazol-1-ylpyrimidin-4-yl)hydrazine (PubChem CID 80968413) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is (2-cyclopropyl-6-indazol-1-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (2-cyclopropyl-6-indazol-1-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 80968413 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2-cyclopropyl-6-indazol-1-ylpyrimidin-4-yl)hydrazine |
| SMILES | NNc1cc(-n2ncc3ccccc32)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H14N6/c15-19-12-7-13(18-14(17-12)9-5-6-9)20-11-4-2-1-3-10(11)8-16-20/h1-4,7-9H,5-6,15H2,(H,17,18,19) |
| InChIKey | DUYTXCJACDYEOW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|