C8H14N4O2 — CID 103436547
5-(2,6-dimethylmorpholin-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 103436547) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 103436547 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CC1CN(c2nnc(N)o2)CC(C)O1 |
| InChI | InChI=1S/C8H14N4O2/c1-5-3-12(4-6(2)13-5)8-11-10-7(9)14-8/h5-6H,3-4H2,1-2H3,(H2,9,10) |
| InChIKey | OAFVKZQVCAISOT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |