C9H13ClN2O2 — CID 151651252
4-(5-chloro-1,3-oxazol-2-yl)-2,6-dimethylmorpholine (PubChem CID 151651252) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-(5-chloro-1,3-oxazol-2-yl)-2,6-dimethylmorpholine.
| Compound Name | 4-(5-chloro-1,3-oxazol-2-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 151651252 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-(5-chloro-1,3-oxazol-2-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ncc(Cl)o2)CC(C)O1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-6-4-12(5-7(2)13-6)9-11-3-8(10)14-9/h3,6-7H,4-5H2,1-2H3 |
| InChIKey | QUODQTVAPDUYFG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |