C9H14N4O2 — CID 103436782
5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 103436782) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 103436782 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 5-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(N2CCOC3CCCC32)o1 |
| InChI | InChI=1S/C9H14N4O2/c10-8-11-12-9(15-8)13-4-5-14-7-3-1-2-6(7)13/h6-7H,1-5H2,(H2,10,11) |
| InChIKey | NGYMTIUGIVZIAH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |