C12H17N3O — CID 98775699
(4aR,8aR)-4-pyrimidin-2-yl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 98775699) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is (4aR,8aR)-4-pyrimidin-2-yl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aR,8aR)-4-pyrimidin-2-yl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 98775699 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | (4aR,8aR)-4-pyrimidin-2-yl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | c1cnc(N2CCO[C@@H]3CCCC[C@H]32)nc1 |
| InChI | InChI=1S/C12H17N3O/c1-2-5-11-10(4-1)15(8-9-16-11)12-13-6-3-7-14-12/h3,6-7,10-11H,1-2,4-5,8-9H2/t10-,11-/m1/s1 |
| InChIKey | USLFZHAQIXFRAG-GHMZBOCLSA-N |
| XLogP | 1.62 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |