C16H20N4O — CID 102986147
3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)quinoxalin-2-amine (PubChem CID 102986147) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)quinoxalin-2-amine.
| Compound Name | 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 102986147 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 3-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)quinoxalin-2-amine |
| SMILES | Nc1nc2ccccc2nc1N1CCOC2CCCCC21 |
| InChI | InChI=1S/C16H20N4O/c17-15-16(19-12-6-2-1-5-11(12)18-15)20-9-10-21-14-8-4-3-7-13(14)20/h1-2,5-6,13-14H,3-4,7-10H2,(H2,17,18) |
| InChIKey | XMNHXAAGSPDTPP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |