C17H20N2O2 — CID 106768161
[1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)isoquinolin-4-yl]methanol (PubChem CID 106768161) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is [1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)isoquinolin-4-yl]methanol.
| Compound Name | [1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)isoquinolin-4-yl]methanol |
|---|---|
| PubChem CID | 106768161 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [1-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)isoquinolin-4-yl]methanol |
| SMILES | OCc1cnc(N2CCOC3CCCC32)c2ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c20-11-12-10-18-17(14-5-2-1-4-13(12)14)19-8-9-21-16-7-3-6-15(16)19/h1-2,4-5,10,15-16,20H,3,6-9,11H2 |
| InChIKey | VUGORYOABLHILH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |