C17H21N3O — CID 62181955
3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)quinolin-2-amine (PubChem CID 62181955) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)quinolin-2-amine.
| Compound Name | 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)quinolin-2-amine |
|---|---|
| PubChem CID | 62181955 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)quinolin-2-amine |
| SMILES | Nc1nc2ccccc2cc1CN1CCOC2CCCC21 |
| InChI | InChI=1S/C17H21N3O/c18-17-13(10-12-4-1-2-5-14(12)19-17)11-20-8-9-21-16-7-3-6-15(16)20/h1-2,4-5,10,15-16H,3,6-9,11H2,(H2,18,19) |
| InChIKey | OTQZTYMEWGGANB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |