C14H17BrClNO — CID 113228500
4-[(4-bromo-2-chlorophenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 113228500) has the molecular formula C14H17BrClNO and a molecular weight of 330.65 g/mol. Its IUPAC name is 4-[(4-bromo-2-chlorophenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-[(4-bromo-2-chlorophenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 113228500 |
| Molecular Formula | C14H17BrClNO |
| Molecular Weight | 330.65 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 4-[(4-bromo-2-chlorophenyl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Clc1cc(Br)ccc1CN1CCOC2CCCC21 |
| InChI | InChI=1S/C14H17BrClNO/c15-11-5-4-10(12(16)8-11)9-17-6-7-18-14-3-1-2-13(14)17/h4-5,8,13-14H,1-3,6-7,9H2 |
| InChIKey | WVBJNBZCPAIPLV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |