C17H25BrN2O — CID 102770301
N-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-3-bromophenyl]methyl]ethanamine (PubChem CID 102770301) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-3-bromophenyl]methyl]ethanamine.
| Compound Name | N-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-3-bromophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102770301 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-[[4-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-ylmethyl)-3-bromophenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(CN2CCOC3CCCC32)c(Br)c1 |
| InChI | InChI=1S/C17H25BrN2O/c1-2-19-11-13-6-7-14(15(18)10-13)12-20-8-9-21-17-5-3-4-16(17)20/h6-7,10,16-17,19H,2-5,8-9,11-12H2,1H3 |
| InChIKey | BOWBRZJDHKDZKV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |