About N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine
N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine (PubChem CID 102772024) has the molecular formula C16H25BrN2
and a molecular weight of 325.29 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine |
| PubChem CID | 102772024 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(CN2CC(C)CC2C)c(Br)c1 |
| InChI | InChI=1S/C16H25BrN2/c1-4-18-9-14-5-6-15(16(17)8-14)11-19-10-12(2)7-13(19)3/h5-6,8,12-13,18H,4,7,9-11H2,1-3H3 |
| InChIKey | KZBRQESZNZVYAO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine?
The IUPAC name of N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine (CID 102772024) is N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine.
What is the SMILES notation for N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine?
The canonical SMILES for N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine is CCNCc1ccc(CN2CC(C)CC2C)c(Br)c1.
What is the InChIKey of N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine?
The InChIKey is KZBRQESZNZVYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25BrN2/c1-4-18-9-14-5-6-15(16(17)8-14)11-19-10-12(2)7-13(19)3/h5-6,8,12-13,18H,4,7,9-11H2,1-3H3.
What are the key properties of N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine?
N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine has a molecular weight of 325.29 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-bromo-4-[(2,4-dimethylpyrrolidin-1-yl)methyl]phenyl]methyl]ethanamine is sourced from PubChem (CID 102772024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).