C14H17N3O2 — CID 94196147
(3S,6R)-1-(1,3-benzoxazol-2-yl)-6-methylpiperidine-3-carboxamide (PubChem CID 94196147) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (3S,6R)-1-(1,3-benzoxazol-2-yl)-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6R)-1-(1,3-benzoxazol-2-yl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94196147 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (3S,6R)-1-(1,3-benzoxazol-2-yl)-6-methylpiperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)CN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-6-7-10(13(15)18)8-17(9)14-16-11-4-2-3-5-12(11)19-14/h2-5,9-10H,6-8H2,1H3,(H2,15,18)/t9-,10+/m1/s1 |
| InChIKey | CZAWRSYGCDZMJB-ZJUUUORDSA-N |
| XLogP | 1.92 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |