C17H23N3O — CID 79882584
2-(3-azaspiro[5.5]undecan-3-yl)-1,3-benzoxazol-6-amine (PubChem CID 79882584) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(3-azaspiro[5.5]undecan-3-yl)-1,3-benzoxazol-6-amine.
| Compound Name | 2-(3-azaspiro[5.5]undecan-3-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79882584 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 2-(3-azaspiro[5.5]undecan-3-yl)-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(N3CCC4(CCCCC4)CC3)oc2c1 |
| InChI | InChI=1S/C17H23N3O/c18-13-4-5-14-15(12-13)21-16(19-14)20-10-8-17(9-11-20)6-2-1-3-7-17/h4-5,12H,1-3,6-11,18H2 |
| InChIKey | DYEZJBSWQKSNMJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|