C12H14N4O3 — CID 83094750
4-(6-amino-1,3-benzoxazol-2-yl)morpholine-3-carboxamide (PubChem CID 83094750) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-(6-amino-1,3-benzoxazol-2-yl)morpholine-3-carboxamide.
| Compound Name | 4-(6-amino-1,3-benzoxazol-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83094750 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(6-amino-1,3-benzoxazol-2-yl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1c1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C12H14N4O3/c13-7-1-2-8-10(5-7)19-12(15-8)16-3-4-18-6-9(16)11(14)17/h1-2,5,9H,3-4,6,13H2,(H2,14,17) |
| InChIKey | CUVDKJGNFFMHQF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|