C11H16N4O4S — CID 83094213
4-(4-amino-2-sulfamoylphenyl)morpholine-3-carboxamide (PubChem CID 83094213) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(4-amino-2-sulfamoylphenyl)morpholine-3-carboxamide.
| Compound Name | 4-(4-amino-2-sulfamoylphenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83094213 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4-(4-amino-2-sulfamoylphenyl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1c1ccc(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H16N4O4S/c12-7-1-2-8(10(5-7)20(14,17)18)15-3-4-19-6-9(15)11(13)16/h1-2,5,9H,3-4,6,12H2,(H2,13,16)(H2,14,17,18) |
| InChIKey | FNCGTQHMUBNHHA-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|