C12H15N3O — CID 11053104
6-piperidin-1-yl-1,3-benzoxazol-2-amine (PubChem CID 11053104) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 6-piperidin-1-yl-1,3-benzoxazol-2-amine.
| Compound Name | 6-piperidin-1-yl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 11053104 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 6-piperidin-1-yl-1,3-benzoxazol-2-amine |
| SMILES | Nc1nc2ccc(N3CCCCC3)cc2o1 |
| InChI | InChI=1S/C12H15N3O/c13-12-14-10-5-4-9(8-11(10)16-12)15-6-2-1-3-7-15/h4-5,8H,1-3,6-7H2,(H2,13,14) |
| InChIKey | UNMKMBFGTQNWQO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |