C17H27N6S+ — CID 9098357
dimethyl-[3-[[methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]carbamothioyl]amino]propyl]azanium (PubChem CID 9098357) has the molecular formula C17H27N6S+ and a molecular weight of 347.51 g/mol. Its IUPAC name is dimethyl-[3-[[methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]carbamothioyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]carbamothioyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9098357 |
| Molecular Formula | C17H27N6S+ |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | dimethyl-[3-[[methyl-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]carbamothioyl]amino]propyl]azanium |
| SMILES | C[C@H](c1ccc(-n2cncn2)cc1)N(C)C(=S)NCCC[NH+](C)C |
| InChI | InChI=1S/C17H26N6S/c1-14(22(4)17(24)19-10-5-11-21(2)3)15-6-8-16(9-7-15)23-13-18-12-20-23/h6-9,12-14H,5,10-11H2,1-4H3,(H,19,24)/p+1/t14-/m1/s1 |
| InChIKey | LFJGGKIQJBYOPW-CQSZACIVSA-O |
| XLogP | 0.67 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|