C19H22FN5O2S — CID 9234684
1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-4-(3-fluorophenyl)tetrazole-5-thione (PubChem CID 9234684) has the molecular formula C19H22FN5O2S and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-4-(3-fluorophenyl)tetrazole-5-thione.
| Compound Name | 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-4-(3-fluorophenyl)tetrazole-5-thione |
|---|---|
| PubChem CID | 9234684 |
| Molecular Formula | C19H22FN5O2S |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]methyl]-4-(3-fluorophenyl)tetrazole-5-thione |
| SMILES | COc1cc(C)c(CN(C)Cn2nnn(-c3cccc(F)c3)c2=S)cc1OC |
| InChI | InChI=1S/C19H22FN5O2S/c1-13-8-17(26-3)18(27-4)9-14(13)11-23(2)12-24-19(28)25(22-21-24)16-7-5-6-15(20)10-16/h5-10H,11-12H2,1-4H3 |
| InChIKey | KFWNJHMMZNRCMY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|