C17H21N5S3 — CID 9322302
3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione (PubChem CID 9322302) has the molecular formula C17H21N5S3 and a molecular weight of 391.59 g/mol. Its IUPAC name is 3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9322302 |
| Molecular Formula | C17H21N5S3 |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-propylsulfanyl-1,3,4-thiadiazole-2-thione |
| SMILES | CCCSc1nn(CN(C)Cc2cnn(-c3ccccc3)c2)c(=S)s1 |
| InChI | InChI=1S/C17H21N5S3/c1-3-9-24-16-19-22(17(23)25-16)13-20(2)11-14-10-18-21(12-14)15-7-5-4-6-8-15/h4-8,10,12H,3,9,11,13H2,1-2H3 |
| InChIKey | HRIZSFAWWXPHCR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|