C20H21N5S — CID 31388003
1-methyl-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione (PubChem CID 31388003) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is 1-methyl-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione.
| Compound Name | 1-methyl-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione |
|---|---|
| PubChem CID | 31388003 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 1-methyl-3-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)Cn1c(=S)n(C)c2ccccc21 |
| InChI | InChI=1S/C20H21N5S/c1-22(13-16-12-21-25(14-16)17-8-4-3-5-9-17)15-24-19-11-7-6-10-18(19)23(2)20(24)26/h3-12,14H,13,15H2,1-2H3 |
| InChIKey | IBXIMRWCEBKVQX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|