C15H17F2N5S — CID 31978461
1-(difluoromethyl)-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione (PubChem CID 31978461) has the molecular formula C15H17F2N5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-(difluoromethyl)-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione.
| Compound Name | 1-(difluoromethyl)-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione |
|---|---|
| PubChem CID | 31978461 |
| Molecular Formula | C15H17F2N5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-(difluoromethyl)-3-[[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methyl]benzimidazole-2-thione |
| SMILES | CN(Cc1cnn(C)c1)Cn1c(=S)n(C(F)F)c2ccccc21 |
| InChI | InChI=1S/C15H17F2N5S/c1-19(8-11-7-18-20(2)9-11)10-21-12-5-3-4-6-13(12)22(14(16)17)15(21)23/h3-7,9,14H,8,10H2,1-2H3 |
| InChIKey | WQACRQKWSYOFCI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|