C20H20N4S2 — CID 17466254
3-[[(1-benzylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzothiazole-2-thione (PubChem CID 17466254) has the molecular formula C20H20N4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 3-[[(1-benzylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzothiazole-2-thione.
| Compound Name | 3-[[(1-benzylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 17466254 |
| Molecular Formula | C20H20N4S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-[[(1-benzylpyrazol-4-yl)methyl-methylamino]methyl]-1,3-benzothiazole-2-thione |
| SMILES | CN(Cc1cnn(Cc2ccccc2)c1)Cn1c(=S)sc2ccccc21 |
| InChI | InChI=1S/C20H20N4S2/c1-22(15-24-18-9-5-6-10-19(18)26-20(24)25)12-17-11-21-23(14-17)13-16-7-3-2-4-8-16/h2-11,14H,12-13,15H2,1H3 |
| InChIKey | RVXGGLWHZUGYHH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|