C18H18N6S2 — CID 9322014
2-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione (PubChem CID 9322014) has the molecular formula C18H18N6S2 and a molecular weight of 382.52 g/mol. Its IUPAC name is 2-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9322014 |
| Molecular Formula | C18H18N6S2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[[methyl-[(1-phenylpyrazol-4-yl)methyl]amino]methyl]-5-thiophen-2-yl-1H-1,2,4-triazole-3-thione |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)Cn1[nH]c(-c2cccs2)nc1=S |
| InChI | InChI=1S/C18H18N6S2/c1-22(11-14-10-19-23(12-14)15-6-3-2-4-7-15)13-24-18(25)20-17(21-24)16-8-5-9-26-16/h2-10,12H,11,13H2,1H3,(H,20,21,25) |
| InChIKey | VMYDJFZTUMLUTO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|