C14H20N4S3 — CID 46664888
3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-methylsulfanyl-1,3,4-thiadiazole-2-thione (PubChem CID 46664888) has the molecular formula C14H20N4S3 and a molecular weight of 340.54 g/mol. Its IUPAC name is 3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-methylsulfanyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-methylsulfanyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 46664888 |
| Molecular Formula | C14H20N4S3 |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-[[[4-(dimethylamino)phenyl]methyl-methylamino]methyl]-5-methylsulfanyl-1,3,4-thiadiazole-2-thione |
| SMILES | CSc1nn(CN(C)Cc2ccc(N(C)C)cc2)c(=S)s1 |
| InChI | InChI=1S/C14H20N4S3/c1-16(2)12-7-5-11(6-8-12)9-17(3)10-18-14(19)21-13(15-18)20-4/h5-8H,9-10H2,1-4H3 |
| InChIKey | UTCKQLABQCADQH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|