C17H26N4S2 — CID 9243566
3-[[methyl-[(4-propan-2-ylphenyl)methyl]amino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9243566) has the molecular formula C17H26N4S2 and a molecular weight of 350.56 g/mol. Its IUPAC name is 3-[[methyl-[(4-propan-2-ylphenyl)methyl]amino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[methyl-[(4-propan-2-ylphenyl)methyl]amino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9243566 |
| Molecular Formula | C17H26N4S2 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[[methyl-[(4-propan-2-ylphenyl)methyl]amino]methyl]-5-(propylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | CCCNc1nn(CN(C)Cc2ccc(C(C)C)cc2)c(=S)s1 |
| InChI | InChI=1S/C17H26N4S2/c1-5-10-18-16-19-21(17(22)23-16)12-20(4)11-14-6-8-15(9-7-14)13(2)3/h6-9,13H,5,10-12H2,1-4H3,(H,18,19) |
| InChIKey | UEDJYVXKQIUOIQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|