C16H23ClN4OS2 — CID 9279319
3-[[(4-chlorophenyl)methyl-methylamino]methyl]-5-(3-ethoxypropylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9279319) has the molecular formula C16H23ClN4OS2 and a molecular weight of 386.97 g/mol. Its IUPAC name is 3-[[(4-chlorophenyl)methyl-methylamino]methyl]-5-(3-ethoxypropylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[(4-chlorophenyl)methyl-methylamino]methyl]-5-(3-ethoxypropylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9279319 |
| Molecular Formula | C16H23ClN4OS2 |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-[[(4-chlorophenyl)methyl-methylamino]methyl]-5-(3-ethoxypropylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | CCOCCCNc1nn(CN(C)Cc2ccc(Cl)cc2)c(=S)s1 |
| InChI | InChI=1S/C16H23ClN4OS2/c1-3-22-10-4-9-18-15-19-21(16(23)24-15)12-20(2)11-13-5-7-14(17)8-6-13/h5-8H,3-4,9-12H2,1-2H3,(H,18,19) |
| InChIKey | NKUIXWCXDKBBLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|