C22H26N4OS3 — CID 17475911
2-[[4-[[benzhydryl(methyl)amino]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide (PubChem CID 17475911) has the molecular formula C22H26N4OS3 and a molecular weight of 458.68 g/mol. Its IUPAC name is 2-[[4-[[benzhydryl(methyl)amino]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide.
| Compound Name | 2-[[4-[[benzhydryl(methyl)amino]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
|---|---|
| PubChem CID | 17475911 |
| Molecular Formula | C22H26N4OS3 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-[[4-[[benzhydryl(methyl)amino]methyl]-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]-N-propylacetamide |
| SMILES | CCCNC(=O)CSc1nn(CN(C)C(c2ccccc2)c2ccccc2)c(=S)s1 |
| InChI | InChI=1S/C22H26N4OS3/c1-3-14-23-19(27)15-29-21-24-26(22(28)30-21)16-25(2)20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,20H,3,14-16H2,1-2H3,(H,23,27) |
| InChIKey | QXLKVEFCFQHHFI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|