C20H30N6OS — CID 24505272
2-[methyl-[(4-phenyl-3-piperidin-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]-N-propylacetamide (PubChem CID 24505272) has the molecular formula C20H30N6OS and a molecular weight of 402.57 g/mol. Its IUPAC name is 2-[methyl-[(4-phenyl-3-piperidin-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]-N-propylacetamide.
| Compound Name | 2-[methyl-[(4-phenyl-3-piperidin-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 24505272 |
| Molecular Formula | C20H30N6OS |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[methyl-[(4-phenyl-3-piperidin-1-yl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)Cn1nc(N2CCCCC2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C20H30N6OS/c1-3-12-21-18(27)15-23(2)16-25-20(28)26(17-10-6-4-7-11-17)19(22-25)24-13-8-5-9-14-24/h4,6-7,10-11H,3,5,8-9,12-16H2,1-2H3,(H,21,27) |
| InChIKey | MMMCXKVKMFIHRP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|