C16H24N6OS — CID 9244153
2-[[4-(2,6-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]-N-propylacetamide (PubChem CID 9244153) has the molecular formula C16H24N6OS and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[[4-(2,6-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]-N-propylacetamide.
| Compound Name | 2-[[4-(2,6-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 9244153 |
| Molecular Formula | C16H24N6OS |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[[4-(2,6-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)Cn1nnn(-c2c(C)cccc2C)c1=S |
| InChI | InChI=1S/C16H24N6OS/c1-5-9-17-14(23)10-20(4)11-21-16(24)22(19-18-21)15-12(2)7-6-8-13(15)3/h6-8H,5,9-11H2,1-4H3,(H,17,23) |
| InChIKey | ASGLUOFFEYYODH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|