C17H26N6OS — CID 9280989
N-tert-butyl-2-[[4-(2,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]acetamide (PubChem CID 9280989) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is N-tert-butyl-2-[[4-(2,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[4-(2,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9280989 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-tert-butyl-2-[[4-(2,4-dimethylphenyl)-5-sulfanylidenetetrazol-1-yl]methyl-methylamino]acetamide |
| SMILES | Cc1ccc(-n2nnn(CN(C)CC(=O)NC(C)(C)C)c2=S)c(C)c1 |
| InChI | InChI=1S/C17H26N6OS/c1-12-7-8-14(13(2)9-12)23-16(25)22(19-20-23)11-21(6)10-15(24)18-17(3,4)5/h7-9H,10-11H2,1-6H3,(H,18,24) |
| InChIKey | KITGOXFAGWKKDX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|