C19H26FN5OS — CID 9281152
N-tert-butyl-2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]acetamide (PubChem CID 9281152) has the molecular formula C19H26FN5OS and a molecular weight of 391.52 g/mol. Its IUPAC name is N-tert-butyl-2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]acetamide.
| Compound Name | N-tert-butyl-2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9281152 |
| Molecular Formula | C19H26FN5OS |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-tert-butyl-2-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methylamino]acetamide |
| SMILES | C=CCn1c(-c2ccc(F)cc2)nn(CN(C)CC(=O)NC(C)(C)C)c1=S |
| InChI | InChI=1S/C19H26FN5OS/c1-6-11-24-17(14-7-9-15(20)10-8-14)22-25(18(24)27)13-23(5)12-16(26)21-19(2,3)4/h6-10H,1,11-13H2,2-5H3,(H,21,26) |
| InChIKey | DXIZJKPFPSHRIO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|