C19H21ClN4OS2 — CID 9171964
2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 9171964) has the molecular formula C19H21ClN4OS2 and a molecular weight of 420.99 g/mol. Its IUPAC name is 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9171964 |
| Molecular Formula | C19H21ClN4OS2 |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 2-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2ccc(OC)cc2)nn(CN(C)Cc2ccc(Cl)s2)c1=S |
| InChI | InChI=1S/C19H21ClN4OS2/c1-4-11-23-18(14-5-7-15(25-3)8-6-14)21-24(19(23)26)13-22(2)12-16-9-10-17(20)27-16/h4-10H,1,11-13H2,2-3H3 |
| InChIKey | ARSPZZBRSJTYJJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|