C21H30N4O3S2 — CID 42933821
2-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 42933821) has the molecular formula C21H30N4O3S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42933821 |
| Molecular Formula | C21H30N4O3S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[[butyl-(1,1-dioxothiolan-3-yl)amino]methyl]-5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2ccc(OC)cc2)nn(CN(CCCC)C2CCS(=O)(=O)C2)c1=S |
| InChI | InChI=1S/C21H30N4O3S2/c1-4-6-13-23(18-11-14-30(26,27)15-18)16-25-21(29)24(12-5-2)20(22-25)17-7-9-19(28-3)10-8-17/h5,7-10,18H,2,4,6,11-16H2,1,3H3 |
| InChIKey | WJXBAHCODZJIDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|