C18H24FN4O2S2+ — CID 9242979
[(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]azanium (PubChem CID 9242979) has the molecular formula C18H24FN4O2S2+ and a molecular weight of 411.55 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9242979 |
| Molecular Formula | C18H24FN4O2S2+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-ethyl-[[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]azanium |
| SMILES | C=CCn1c(-c2ccc(F)cc2)nn(C[NH+](CC)[C@H]2CCS(=O)(=O)C2)c1=S |
| InChI | InChI=1S/C18H23FN4O2S2/c1-3-10-22-17(14-5-7-15(19)8-6-14)20-23(18(22)26)13-21(4-2)16-9-11-27(24,25)12-16/h3,5-8,16H,1,4,9-13H2,2H3/p+1/t16-/m0/s1 |
| InChIKey | KDUMAGGLQBJINL-INIZCTEOSA-O |
| XLogP | 1.46 |
| TPSA | 61.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|