C15H19ClN3O3S2+ — CID 9243397
[5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl-[(3S)-1,1-dioxothiolan-3-yl]-ethylazanium (PubChem CID 9243397) has the molecular formula C15H19ClN3O3S2+ and a molecular weight of 388.92 g/mol. Its IUPAC name is [5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl-[(3S)-1,1-dioxothiolan-3-yl]-ethylazanium.
| Compound Name | [5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl-[(3S)-1,1-dioxothiolan-3-yl]-ethylazanium |
|---|---|
| PubChem CID | 9243397 |
| Molecular Formula | C15H19ClN3O3S2+ |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [5-(3-chlorophenyl)-2-sulfanylidene-1,3,4-oxadiazol-3-yl]methyl-[(3S)-1,1-dioxothiolan-3-yl]-ethylazanium |
| SMILES | CC[NH+](Cn1nc(-c2cccc(Cl)c2)oc1=S)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18ClN3O3S2/c1-2-18(13-6-7-24(20,21)9-13)10-19-15(23)22-14(17-19)11-4-3-5-12(16)8-11/h3-5,8,13H,2,6-7,9-10H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | HOWBKKTVLLFINE-ZDUSSCGKSA-O |
| XLogP | 1.58 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|