C17H24ClN4O2S2+ — CID 9242647
[3-(4-chlorophenyl)-4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-[(3R)-1,1-dioxothiolan-3-yl]-ethylazanium (PubChem CID 9242647) has the molecular formula C17H24ClN4O2S2+ and a molecular weight of 415.99 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-[(3R)-1,1-dioxothiolan-3-yl]-ethylazanium.
| Compound Name | [3-(4-chlorophenyl)-4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-[(3R)-1,1-dioxothiolan-3-yl]-ethylazanium |
|---|---|
| PubChem CID | 9242647 |
| Molecular Formula | C17H24ClN4O2S2+ |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [3-(4-chlorophenyl)-4-ethyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-[(3R)-1,1-dioxothiolan-3-yl]-ethylazanium |
| SMILES | CCn1c(-c2ccc(Cl)cc2)nn(C[NH+](CC)[C@@H]2CCS(=O)(=O)C2)c1=S |
| InChI | InChI=1S/C17H23ClN4O2S2/c1-3-20(15-9-10-26(23,24)11-15)12-22-17(25)21(4-2)16(19-22)13-5-7-14(18)8-6-13/h5-8,15H,3-4,9-12H2,1-2H3/p+1/t15-/m1/s1 |
| InChIKey | CKDICBFQJACVGW-OAHLLOKOSA-O |
| XLogP | 1.80 |
| TPSA | 61.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|