C18H20FN4S2+ — CID 9319055
[3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methyl-(thiophen-3-ylmethyl)azanium (PubChem CID 9319055) has the molecular formula C18H20FN4S2+ and a molecular weight of 375.52 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methyl-(thiophen-3-ylmethyl)azanium.
| Compound Name | [3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methyl-(thiophen-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 9319055 |
| Molecular Formula | C18H20FN4S2+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [3-(4-fluorophenyl)-4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl-methyl-(thiophen-3-ylmethyl)azanium |
| SMILES | C=CCn1c(-c2ccc(F)cc2)nn(C[NH+](C)Cc2ccsc2)c1=S |
| InChI | InChI=1S/C18H19FN4S2/c1-3-9-22-17(15-4-6-16(19)7-5-15)20-23(18(22)24)13-21(2)11-14-8-10-25-12-14/h3-8,10,12H,1,9,11,13H2,2H3/p+1 |
| InChIKey | LDNYFIKPYQCVER-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|